Difference between revisions of "CPD-5169"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14808 == * common-name: ** scyllo-inosose * smiles: ** c1(c(c(c(c(c1o)o)=o)o)o)o * inchi-key: ** vyegbdhsghxogt-hyfglkjpsa-n * molecu...") |
(Created page with "Category:metabolite == Metabolite tRNA-Containing-N1-Methylguanine-9 == * common-name: ** an n1-methylguanine9 in trna == Reaction(s) known to consume the compound == == R...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite tRNA-Containing-N1-Methylguanine-9 == |
* common-name: | * common-name: | ||
| − | ** | + | ** an n1-methylguanine9 in trna |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-12459]] | |
| − | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an n1-methylguanine9 in trna}} |
| − | |||
| − | |||
Revision as of 14:56, 5 January 2021
Contents
Metabolite tRNA-Containing-N1-Methylguanine-9
- common-name:
- an n1-methylguanine9 in trna
