Difference between revisions of "CPD-5169"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite tRNA-Containing-N1-Methylguanine-9 == * common-name: ** an n1-methylguanine9 in trna == Reaction(s) known to consume the compound == == R...") |
(Created page with "Category:metabolite == Metabolite CPD-14159 == * common-name: ** 6''-o-carbamoylkanamycin b * smiles: ** c([n+])c1(c(o)c(o)c([n+])c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(coc(=o)n)...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-14159 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 6''-o-carbamoylkanamycin b |
| + | * smiles: | ||
| + | ** c([n+])c1(c(o)c(o)c([n+])c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(coc(=o)n)c(o)c([n+])c(o)3))[n+])) | ||
| + | * inchi-key: | ||
| + | ** xcstznjiqfivpe-fqsmhnglsa-s | ||
| + | * molecular-weight: | ||
| + | ** 531.582 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-14553]] |
| + | * [[RXN-15287]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=6''-o-carbamoylkanamycin b}} |
| + | {{#set: inchi-key=inchikey=xcstznjiqfivpe-fqsmhnglsa-s}} | ||
| + | {{#set: molecular-weight=531.582}} | ||
Revision as of 15:27, 5 January 2021
Contents
Metabolite CPD-14159
- common-name:
- 6-o-carbamoylkanamycin b
- smiles:
- c([n+])c1(c(o)c(o)c([n+])c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(coc(=o)n)c(o)c([n+])c(o)3))[n+]))
- inchi-key:
- xcstznjiqfivpe-fqsmhnglsa-s
- molecular-weight:
- 531.582
