Difference between revisions of "CPD-5169"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14159 == * common-name: ** 6''-o-carbamoylkanamycin b * smiles: ** c([n+])c1(c(o)c(o)c([n+])c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(coc(=o)n)...")
(Created page with "Category:metabolite == Metabolite L-methionyl-glycyl-Protein == * common-name: ** an n-terminal-l-methionyl-glycyl-[protein] == Reaction(s) known to consume the compound =...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14159 ==
+
== Metabolite L-methionyl-glycyl-Protein ==
 
* common-name:
 
* common-name:
** 6''-o-carbamoylkanamycin b
+
** an n-terminal-l-methionyl-glycyl-[protein]
* smiles:
 
** c([n+])c1(c(o)c(o)c([n+])c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(coc(=o)n)c(o)c([n+])c(o)3))[n+]))
 
* inchi-key:
 
** xcstznjiqfivpe-fqsmhnglsa-s
 
* molecular-weight:
 
** 531.582
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-17875]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14553]]
 
* [[RXN-15287]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=6''-o-carbamoylkanamycin b}}
+
{{#set: common-name=an n-terminal-l-methionyl-glycyl-[protein]}}
{{#set: inchi-key=inchikey=xcstznjiqfivpe-fqsmhnglsa-s}}
 
{{#set: molecular-weight=531.582}}
 

Revision as of 13:10, 14 January 2021

Metabolite L-methionyl-glycyl-Protein

  • common-name:
    • an n-terminal-l-methionyl-glycyl-[protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an n-terminal-l-methionyl-glycyl-[protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.