Difference between revisions of "CPD-520"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite FRUCTOSE-16-DIPHOSPHATE == * common-name: ** β-d-fructose 1,6-bisphosphate * smiles: ** c(c1(c(c(c(o1)(cop(=o)([o-])[o-])o)o)o))op([...")
(Created page with "Category:metabolite == Metabolite ALA-GLY == * common-name: ** l-alanyl-glycine * smiles: ** cc([n+])c(ncc([o-])=o)=o * inchi-key: ** cxispyvymqwfle-vkhmyheasa-n * molecul...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite FRUCTOSE-16-DIPHOSPHATE ==
+
== Metabolite ALA-GLY ==
 
* common-name:
 
* common-name:
** β-d-fructose 1,6-bisphosphate
+
** l-alanyl-glycine
 
* smiles:
 
* smiles:
** c(c1(c(c(c(o1)(cop(=o)([o-])[o-])o)o)o))op([o-])(=o)[o-]
+
** cc([n+])c(ncc([o-])=o)=o
 
* inchi-key:
 
* inchi-key:
** rnbgygvwrkecfj-arqdhwqxsa-j
+
** cxispyvymqwfle-vkhmyheasa-n
 
* molecular-weight:
 
* molecular-weight:
** 336.085
+
** 146.146
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.7.1.90-RXN]]
+
* [[RXN0-6977]]
* [[F16ALDOLASE-RXN]]
 
* [[F16BDEPHOS-RXN]]
 
* [[FBA_]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.7.1.90-RXN]]
 
* [[6PFRUCTPHOS-RXN]]
 
* [[F16ALDOLASE-RXN]]
 
* [[FBA_]]
 
* [[PFK_]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=β-d-fructose 1,6-bisphosphate}}
+
{{#set: common-name=l-alanyl-glycine}}
{{#set: inchi-key=inchikey=rnbgygvwrkecfj-arqdhwqxsa-j}}
+
{{#set: inchi-key=inchikey=cxispyvymqwfle-vkhmyheasa-n}}
{{#set: molecular-weight=336.085}}
+
{{#set: molecular-weight=146.146}}

Revision as of 08:24, 15 March 2021

Metabolite ALA-GLY

  • common-name:
    • l-alanyl-glycine
  • smiles:
    • cc([n+])c(ncc([o-])=o)=o
  • inchi-key:
    • cxispyvymqwfle-vkhmyheasa-n
  • molecular-weight:
    • 146.146

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality