Difference between revisions of "CPD-520"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite FRUCTOSE-16-DIPHOSPHATE == * common-name: ** β-d-fructose 1,6-bisphosphate * smiles: ** c(c1(c(c(c(o1)(cop(=o)([o-])[o-])o)o)o))op([...")
(Created page with "Category:metabolite == Metabolite CPD-520 == * common-name: ** quercetin * smiles: ** c1(c=c(o)c(o)=cc=1c2(oc3(=c(c(=o)c=2[o-])c(o)=cc(o)=c3))) * inchi-key: ** refjwtpedvj...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite FRUCTOSE-16-DIPHOSPHATE ==
+
== Metabolite CPD-520 ==
 
* common-name:
 
* common-name:
** β-d-fructose 1,6-bisphosphate
+
** quercetin
 
* smiles:
 
* smiles:
** c(c1(c(c(c(o1)(cop(=o)([o-])[o-])o)o)o))op([o-])(=o)[o-]
+
** c1(c=c(o)c(o)=cc=1c2(oc3(=c(c(=o)c=2[o-])c(o)=cc(o)=c3)))
 
* inchi-key:
 
* inchi-key:
** rnbgygvwrkecfj-arqdhwqxsa-j
+
** refjwtpedvjjiy-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 336.085
+
** 301.232
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.7.1.90-RXN]]
+
* [[QUERCETIN-23-DIOXYGENASE-RXN]]
* [[F16ALDOLASE-RXN]]
+
* [[QUERCETIN-3-O-METHYLTRANSFERASE-RXN]]
* [[F16BDEPHOS-RXN]]
+
* [[RXN1F-462]]
* [[FBA_]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.7.1.90-RXN]]
+
* [[RXN-12510]]
* [[6PFRUCTPHOS-RXN]]
+
* [[RXN-527]]
* [[F16ALDOLASE-RXN]]
 
* [[FBA_]]
 
* [[PFK_]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=β-d-fructose 1,6-bisphosphate}}
+
{{#set: common-name=quercetin}}
{{#set: inchi-key=inchikey=rnbgygvwrkecfj-arqdhwqxsa-j}}
+
{{#set: inchi-key=inchikey=refjwtpedvjjiy-uhfffaoysa-m}}
{{#set: molecular-weight=336.085}}
+
{{#set: molecular-weight=301.232}}

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-520

  • common-name:
    • quercetin
  • smiles:
    • c1(c=c(o)c(o)=cc=1c2(oc3(=c(c(=o)c=2[o-])c(o)=cc(o)=c3)))
  • inchi-key:
    • refjwtpedvjjiy-uhfffaoysa-m
  • molecular-weight:
    • 301.232

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality