Difference between revisions of "CPD-520"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ10277 == * transcription-direction: ** positive * right-end-position: ** 327874 * left-end-position: ** 307639 * centisome-position: ** 78.0362...")
(Created page with "Category:metabolite == Metabolite FRUCTOSE-16-DIPHOSPHATE == * common-name: ** β-d-fructose 1,6-bisphosphate * smiles: ** c(c1(c(c(c(o1)(cop(=o)([o-])[o-])o)o)o))op([...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ10277 ==
+
== Metabolite FRUCTOSE-16-DIPHOSPHATE ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** β-d-fructose 1,6-bisphosphate
−
* right-end-position:
+
* smiles:
−
** 327874
+
** c(c1(c(c(c(o1)(cop(=o)([o-])[o-])o)o)o))op([o-])(=o)[o-]
−
* left-end-position:
+
* inchi-key:
−
** 307639
+
** rnbgygvwrkecfj-arqdhwqxsa-j
−
* centisome-position:
+
* molecular-weight:
−
** 78.0362   
+
** 336.085
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[2.7.1.90-RXN]]
−
== Reaction(s) associated ==
+
* [[F16ALDOLASE-RXN]]
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[F16BDEPHOS-RXN]]
−
* [[3.2.1.23-RXN]]
+
* [[FBA_]]
−
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[2.7.1.90-RXN]]
−
** Category: [[orthology]]
+
* [[6PFRUCTPHOS-RXN]]
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[F16ALDOLASE-RXN]]
−
* [[BETAGALACTOSID-RXN]]
+
* [[FBA_]]
−
** Category: [[annotation]]
+
* [[PFK_]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
−
** Category: [[orthology]]
+
{{#set: common-name=&beta;-d-fructose 1,6-bisphosphate}}
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: inchi-key=inchikey=rnbgygvwrkecfj-arqdhwqxsa-j}}
−
* [[KETOLACTOSE-RXN]]
+
{{#set: molecular-weight=336.085}}
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-12398]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-12399]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-12400]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
</div>
 
−
== Pathway(s) associated ==
 
−
* [[BGALACT-PWY]]
 
−
** '''1''' reactions found over '''1''' reactions in the full pathway
 
−
* [[LACTOSEUTIL-PWY]]
 
−
** '''1''' reactions found over '''3''' reactions in the full pathway
 
−
* [[PWY-6807]]
 
−
** '''3''' reactions found over '''8''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=327874}}
 
−
{{#set: left-end-position=307639}}
 
−
{{#set: centisome-position=78.0362    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=6}}
 
−
{{#set: nb pathway associated=3}}
 

Revision as of 20:30, 18 December 2020

Metabolite FRUCTOSE-16-DIPHOSPHATE

  • common-name:
    • β-d-fructose 1,6-bisphosphate
  • smiles:
    • c(c1(c(c(c(o1)(cop(=o)([o-])[o-])o)o)o))op([o-])(=o)[o-]
  • inchi-key:
    • rnbgygvwrkecfj-arqdhwqxsa-j
  • molecular-weight:
    • 336.085

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-520&oldid=45678"