Difference between revisions of "CPD-548"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DGDP == * common-name: ** dgdp * smiles: ** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) * inchi-key: ** cikg...") |
(Created page with "Category:metabolite == Metabolite CPD-548 == * common-name: ** s-formylglutathione * smiles: ** c(nc(=o)c(csc=o)nc(=o)ccc([n+])c(=o)[o-])c(=o)[o-] * inchi-key: ** fhxagoic...") |
||
| (2 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-548 == |
* common-name: | * common-name: | ||
| − | ** | + | ** s-formylglutathione |
* smiles: | * smiles: | ||
| − | ** c( | + | ** c(nc(=o)c(csc=o)nc(=o)ccc([n+])c(=o)[o-])c(=o)[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** fhxagoicbfgebf-bqbzgakwsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 334.323 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN0-276]] |
| − | * [[ | + | * [[S-FORMYLGLUTATHIONE-HYDROLASE-RXN]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-2962]] | |
| − | + | * [[RXN0-276]] | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | * [[RXN- | ||
| − | * [[RXN0- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=s-formylglutathione}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=fhxagoicbfgebf-bqbzgakwsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=334.323}} |
Latest revision as of 11:18, 18 March 2021
Contents
Metabolite CPD-548
- common-name:
- s-formylglutathione
- smiles:
- c(nc(=o)c(csc=o)nc(=o)ccc([n+])c(=o)[o-])c(=o)[o-]
- inchi-key:
- fhxagoicbfgebf-bqbzgakwsa-m
- molecular-weight:
- 334.323
