Difference between revisions of "CPD-556"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-2121 == * common-name: ** trans-hex-2-enoyl-coa * smiles: ** cccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=...")
(Created page with "Category:metabolite == Metabolite CPD-556 == * common-name: ** cholesteryl-β-d-glucoside * smiles: ** cc(c)cccc(c)[ch]1(cc[ch]2(c(c)1cc[ch]3([ch]2cc=c5(c(c)3ccc(oc4(o...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD0-2121 ==
+
== Metabolite CPD-556 ==
 
* common-name:
 
* common-name:
** trans-hex-2-enoyl-coa
+
** cholesteryl-β-d-glucoside
 
* smiles:
 
* smiles:
** cccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cc(c)cccc(c)[ch]1(cc[ch]2(c(c)1cc[ch]3([ch]2cc=c5(c(c)3ccc(oc4(oc(co)c(o)c(o)c(o)4))c5))))
 
* inchi-key:
 
* inchi-key:
** oinxhibnzuuimr-ixuyqxaasa-j
+
** fsmcjunylqoaim-uqbzctsosa-n
 
* molecular-weight:
 
* molecular-weight:
** 859.631
+
** 548.802
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ECOAH2h]]
 
* [[RXN-12559]]
 
* [[RXN-14278]]
 
* [[TRANSENOYLCOARED-RXN-HEXANOYL-COA/NADP//CPD0-2121/NADPH/PROTON.42.]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ECOAH2h]]
+
* [[RXN-12127]]
* [[RXN-12567]]
 
* [[RXN-14278]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=trans-hex-2-enoyl-coa}}
+
{{#set: common-name=cholesteryl-β-d-glucoside}}
{{#set: inchi-key=inchikey=oinxhibnzuuimr-ixuyqxaasa-j}}
+
{{#set: inchi-key=inchikey=fsmcjunylqoaim-uqbzctsosa-n}}
{{#set: molecular-weight=859.631}}
+
{{#set: molecular-weight=548.802}}

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-556

  • common-name:
    • cholesteryl-β-d-glucoside
  • smiles:
    • cc(c)cccc(c)[ch]1(cc[ch]2(c(c)1cc[ch]3([ch]2cc=c5(c(c)3ccc(oc4(oc(co)c(o)c(o)c(o)4))c5))))
  • inchi-key:
    • fsmcjunylqoaim-uqbzctsosa-n
  • molecular-weight:
    • 548.802

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality