Difference between revisions of "CPD-558"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite LANOSTEROL == * common-name: ** lanosterol * smiles: ** cc(c)=cccc([ch]1(c2(c)(c(c)(cc1)c4(=c(cc2)c3([ch](c(c)(c)c(o)cc3)cc4)(c)))))c * i...") |
(Created page with "Category:metabolite == Metabolite CPD-558 == * common-name: ** pimeloyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(cccccc([o-])=o)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-558 == |
* common-name: | * common-name: | ||
| − | ** | + | ** pimeloyl-coa |
* smiles: | * smiles: | ||
| − | ** cc(c)= | + | ** cc(c)(c(o)c(=o)nccc(=o)nccsc(cccccc([o-])=o)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** lycrxmtyuzduga-uyrkptjqsa-i |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 904.649 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[7KAPSYN-RXN]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=pimeloyl-coa}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=lycrxmtyuzduga-uyrkptjqsa-i}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=904.649}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-558
- common-name:
- pimeloyl-coa
- smiles:
- cc(c)(c(o)c(=o)nccc(=o)nccsc(cccccc([o-])=o)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- lycrxmtyuzduga-uyrkptjqsa-i
- molecular-weight:
- 904.649
