Difference between revisions of "CPD-558"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ13300 == * transcription-direction: ** negative * right-end-position: ** 180413 * left-end-position: ** 155939 * centisome-position: ** 45.459686...") |
(Created page with "Category:metabolite == Metabolite CPD-558 == * common-name: ** pimeloyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(cccccc([o-])=o)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[...") |
||
| (7 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-558 == |
| − | * | + | * common-name: |
| − | ** | + | ** pimeloyl-coa |
| − | + | * smiles: | |
| − | + | ** cc(c)(c(o)c(=o)nccc(=o)nccsc(cccccc([o-])=o)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | |
| − | * | + | * inchi-key: |
| − | ** | + | ** lycrxmtyuzduga-uyrkptjqsa-i |
| − | + | * molecular-weight: | |
| − | + | ** 904.649 | |
| − | + | == Reaction(s) known to consume the compound == | |
| − | + | * [[7KAPSYN-RXN]] | |
| − | == | + | == Reaction(s) known to produce the compound == |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=pimeloyl-coa}} | |
| − | + | {{#set: inchi-key=inchikey=lycrxmtyuzduga-uyrkptjqsa-i}} | |
| − | * | + | {{#set: molecular-weight=904.649}} |
| − | ** | ||
| − | * | ||
| − | ** | ||
| − | == | ||
| − | * [[ | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-558
- common-name:
- pimeloyl-coa
- smiles:
- cc(c)(c(o)c(=o)nccc(=o)nccsc(cccccc([o-])=o)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- lycrxmtyuzduga-uyrkptjqsa-i
- molecular-weight:
- 904.649
