Difference between revisions of "CPD-563"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ21798 == * transcription-direction: ** negative * right-end-position: ** 41506 * left-end-position: ** 24465 * centisome-position: ** 4.1395726...") |
(Created page with "Category:metabolite == Metabolite CPD-18312 == * common-name: ** n-3-fumaramoyl-l-2,3-diaminopropanoate * smiles: ** c([o-])(=o)c=cc(=o)ncc([n+])c(n)=o * inchi-key: ** ujv...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-18312 == |
− | * | + | * common-name: |
− | ** | + | ** n-3-fumaramoyl-l-2,3-diaminopropanoate |
− | + | * smiles: | |
− | + | ** c([o-])(=o)c=cc(=o)ncc([n+])c(n)=o | |
− | + | * inchi-key: | |
− | + | ** ujvdeptvvyupmx-qphdtyrisa-n | |
− | * | + | * molecular-weight: |
− | ** | + | ** 201.182 |
− | + | == Reaction(s) known to consume the compound == | |
− | + | * [[RXN-16291]] | |
− | == | + | * [[RXN-16292]] |
− | + | * [[RXN-16293]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | * | + | {{#set: common-name=n-3-fumaramoyl-l-2,3-diaminopropanoate}} |
− | + | {{#set: inchi-key=inchikey=ujvdeptvvyupmx-qphdtyrisa-n}} | |
− | ** | + | {{#set: molecular-weight=201.182}} |
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | ** | ||
− | == | ||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− |
Revision as of 20:33, 18 December 2020
Contents
Metabolite CPD-18312
- common-name:
- n-3-fumaramoyl-l-2,3-diaminopropanoate
- smiles:
- c([o-])(=o)c=cc(=o)ncc([n+])c(n)=o
- inchi-key:
- ujvdeptvvyupmx-qphdtyrisa-n
- molecular-weight:
- 201.182