Difference between revisions of "CPD-564"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11322 RXN-11322] == * direction: ** left-to-right * common-name: ** pyridoxal 5'-phosphate synt...")
(Created page with "Category:metabolite == Metabolite CPD-564 == * common-name: ** s-ribosyl-l-homocysteine * smiles: ** c(cc([n+])c(=o)[o-])scc1(oc(o)c(o)c(o)1) * inchi-key: ** iqfwynfdwrysr...")
 
(7 intermediate revisions by 2 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11322 RXN-11322] ==
+
== Metabolite CPD-564 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** pyridoxal 5'-phosphate synthase
+
** s-ribosyl-l-homocysteine
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/4.3.3.6 ec-4.3.3.6]
+
** c(cc([n+])c(=o)[o-])scc1(oc(o)c(o)c(o)1)
−
* synonymous:
+
* inchi-key:
−
** glutamine amidotransferase subunit pdxt
+
** iqfwynfdwrysra-oeqwsmlssa-n
−
** pyridoxal 5'-phosphate synthase subunit pdxs
+
* molecular-weight:
−
== Reaction formula ==
+
** 267.296
−
* 1 [[CPD-15895]][c] '''+''' 1 [[GAP]][c] '''+''' 1 [[GLN]][c] '''=>''' 1 [[GLT]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[PYRIDOXAL_PHOSPHATE]][c] '''+''' 1 [[Pi]][c] '''+''' 3 [[WATER]][c]
+
== Reaction(s) known to consume the compound ==
−
== Gene(s) associated with this reaction  ==
+
== Reaction(s) known to produce the compound ==
−
* Gene: [[SJ10267]]
+
* [[ADENOSYLHOMOCYSTEINE-NUCLEOSIDASE-RXN]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: common-name=s-ribosyl-l-homocysteine}}
−
* Gene: [[SJ19163]]
+
{{#set: inchi-key=inchikey=iqfwynfdwrysra-oeqwsmlssa-n}}
−
** Category: [[annotation]]
+
{{#set: molecular-weight=267.296}}
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
== Pathway(s) ==
 
−
* [[PWY-6466]], pyridoxal 5'-phosphate biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6466 PWY-6466]
 
−
** '''1''' reactions found over '''1''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=31508 31508]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R07456 R07456]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=pyridoxal 5'-phosphate synthase}}
 
−
{{#set: ec-number=ec-4.3.3.6}}
 
−
{{#set: synonymous=glutamine amidotransferase subunit pdxt|pyridoxal 5'-phosphate synthase subunit pdxs}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-564

  • common-name:
    • s-ribosyl-l-homocysteine
  • smiles:
    • c(cc([n+])c(=o)[o-])scc1(oc(o)c(o)c(o)1)
  • inchi-key:
    • iqfwynfdwrysra-oeqwsmlssa-n
  • molecular-weight:
    • 267.296

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-564&oldid=138958"