Difference between revisions of "CPD-569"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite OCTAPRENYL-METHYL-METHOXY-BENZQ == * common-name: ** 6-methoxy-3-methyl-2-all-trans-octaprenyl-1,4-benzoquinol * smiles: ** cc(=cccc(=ccc...")
(Created page with "Category:metabolite == Metabolite EPOXYSQUALENE == * common-name: ** (3s)-2,3-epoxy-2,3-dihydrosqualene * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc=c(c)ccc=c(c)cc[ch]1(c(c)(c)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite OCTAPRENYL-METHYL-METHOXY-BENZQ ==
+
== Metabolite EPOXYSQUALENE ==
 
* common-name:
 
* common-name:
** 6-methoxy-3-methyl-2-all-trans-octaprenyl-1,4-benzoquinol
+
** (3s)-2,3-epoxy-2,3-dihydrosqualene
 
* smiles:
 
* smiles:
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(=c1c)o)o))c)c)c)c)c)c)c)c
+
** cc(c)=cccc(c)=cccc(c)=cccc=c(c)ccc=c(c)cc[ch]1(c(c)(c)o1)
 
* inchi-key:
 
* inchi-key:
** hdsgdgslnmimku-kfsstaeesa-n
+
** qyimspsdbykppy-rskuxysasa-n
 
* molecular-weight:
 
* molecular-weight:
** 699.111
+
** 426.724
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[CYCLOARTENOL-SYNTHASE-RXN]]
 +
* [[LANOSTEROL-SYNTHASE-RXN]]
 +
* [[SMO]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2-OCTAPRENYL-METHOXY-BENZOQ-METH-RXN]]
+
* [[SMO]]
 +
* [[SQUALENE-MONOOXYGENASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=6-methoxy-3-methyl-2-all-trans-octaprenyl-1,4-benzoquinol}}
+
{{#set: common-name=(3s)-2,3-epoxy-2,3-dihydrosqualene}}
{{#set: inchi-key=inchikey=hdsgdgslnmimku-kfsstaeesa-n}}
+
{{#set: inchi-key=inchikey=qyimspsdbykppy-rskuxysasa-n}}
{{#set: molecular-weight=699.111}}
+
{{#set: molecular-weight=426.724}}

Revision as of 13:12, 14 January 2021

Metabolite EPOXYSQUALENE

  • common-name:
    • (3s)-2,3-epoxy-2,3-dihydrosqualene
  • smiles:
    • cc(c)=cccc(c)=cccc(c)=cccc=c(c)ccc=c(c)cc[ch]1(c(c)(c)o1)
  • inchi-key:
    • qyimspsdbykppy-rskuxysasa-n
  • molecular-weight:
    • 426.724

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality