Difference between revisions of "CPD-5821"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ACETYL-P == * common-name: ** acetyl phosphate * smiles: ** cc(op([o-])(=o)[o-])=o * inchi-key: ** lipounrjvlnbcd-uhfffaoysa-l * molecula...") |
(Created page with "Category:metabolite == Metabolite ALPHA-GLUCOSE-16-BISPHOSPHATE == * common-name: ** α-glucose 1,6-bisphosphate * smiles: ** c(op([o-])(=o)[o-])c1(oc(c(c(c1o)o)o)op(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite ALPHA-GLUCOSE-16-BISPHOSPHATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** α-glucose 1,6-bisphosphate |
* smiles: | * smiles: | ||
| − | ** | + | ** c(op([o-])(=o)[o-])c1(oc(c(c(c1o)o)o)op(=o)([o-])[o-]) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** rwhozgraxywrnx-vfuothlcsa-j |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 336.085 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-16998]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-16997]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=α-glucose 1,6-bisphosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=rwhozgraxywrnx-vfuothlcsa-j}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=336.085}} |
Revision as of 08:29, 15 March 2021
Contents
Metabolite ALPHA-GLUCOSE-16-BISPHOSPHATE
- common-name:
- α-glucose 1,6-bisphosphate
- smiles:
- c(op([o-])(=o)[o-])c1(oc(c(c(c1o)o)o)op(=o)([o-])[o-])
- inchi-key:
- rwhozgraxywrnx-vfuothlcsa-j
- molecular-weight:
- 336.085
