Difference between revisions of "CPD-5821"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ALPHA-GLUCOSE-16-BISPHOSPHATE == * common-name: ** α-glucose 1,6-bisphosphate * smiles: ** c(op([o-])(=o)[o-])c1(oc(c(c(c1o)o)o)op(...")
(Created page with "Category:metabolite == Metabolite CPD-5821 == * common-name: ** (s)-2-oxo-4-hydroxy-4-carboxy-5-ureidoimidazoline * smiles: ** c(c1(o)(nc(=o)n=c1nc(n)=o))(=o)[o-] * inchi-...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ALPHA-GLUCOSE-16-BISPHOSPHATE ==
+
== Metabolite CPD-5821 ==
 
* common-name:
 
* common-name:
** α-glucose 1,6-bisphosphate
+
** (s)-2-oxo-4-hydroxy-4-carboxy-5-ureidoimidazoline
 
* smiles:
 
* smiles:
** c(op([o-])(=o)[o-])c1(oc(c(c(c1o)o)o)op(=o)([o-])[o-])
+
** c(c1(o)(nc(=o)n=c1nc(n)=o))(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** rwhozgraxywrnx-vfuothlcsa-j
+
** whkyncpixmntrq-yfkpbyrvsa-m
 
* molecular-weight:
 
* molecular-weight:
** 336.085
+
** 201.118
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16998]]
+
* [[RXN-6201]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16997]]
+
* [[3.5.2.17-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=α-glucose 1,6-bisphosphate}}
+
{{#set: common-name=(s)-2-oxo-4-hydroxy-4-carboxy-5-ureidoimidazoline}}
{{#set: inchi-key=inchikey=rwhozgraxywrnx-vfuothlcsa-j}}
+
{{#set: inchi-key=inchikey=whkyncpixmntrq-yfkpbyrvsa-m}}
{{#set: molecular-weight=336.085}}
+
{{#set: molecular-weight=201.118}}

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-5821

  • common-name:
    • (s)-2-oxo-4-hydroxy-4-carboxy-5-ureidoimidazoline
  • smiles:
    • c(c1(o)(nc(=o)n=c1nc(n)=o))(=o)[o-]
  • inchi-key:
    • whkyncpixmntrq-yfkpbyrvsa-m
  • molecular-weight:
    • 201.118

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality