Difference between revisions of "CPD-5821"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16150 RXN-16150] == * direction: ** reversible * common-name: ** lysophospholipid densipoloyltr...")
(Created page with "Category:metabolite == Metabolite CPD-5821 == * common-name: ** (s)-2-oxo-4-hydroxy-4-carboxy-5-ureidoimidazoline * smiles: ** c(c1(o)(nc(=o)n=c1nc(n)=o))(=o)[o-] * inchi-...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16150 RXN-16150] ==
+
== Metabolite CPD-5821 ==
−
* direction:
 
−
** reversible
 
 
* common-name:
 
* common-name:
−
** lysophospholipid densipoloyltransferase
+
** (s)-2-oxo-4-hydroxy-4-carboxy-5-ureidoimidazoline
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.3.1.23 ec-2.3.1.23]
+
** c(c1(o)(nc(=o)n=c1nc(n)=o))(=o)[o-]
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CPD-15365]][c] '''+''' 1 [[Glycerolipids]][c] '''<=>''' 1 [[CO-A]][c] '''+''' 1 [[CPD-17397]][c]
+
** whkyncpixmntrq-yfkpbyrvsa-m
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ22477]]
+
** 201.118
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-6201]]
−
* Gene: [[SJ13643]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
* [[3.5.2.17-RXN]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) of unknown directionality ==
−
* Gene: [[SJ09127]]
+
{{#set: common-name=(s)-2-oxo-4-hydroxy-4-carboxy-5-ureidoimidazoline}}
−
** Category: [[orthology]]
+
{{#set: inchi-key=inchikey=whkyncpixmntrq-yfkpbyrvsa-m}}
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
{{#set: molecular-weight=201.118}}
−
== Pathway(s) ==
 
−
* [[PWY-6433]], hydroxylated fatty acid biosynthesis (plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6433 PWY-6433]
 
−
** '''17''' reactions found over '''22''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== External links  ==
 
−
{{#set: direction=reversible}}
 
−
{{#set: common-name=lysophospholipid densipoloyltransferase}}
 
−
{{#set: ec-number=ec-2.3.1.23}}
 
−
{{#set: nb gene associated=3}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation|orthology}}
 
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-5821

  • common-name:
    • (s)-2-oxo-4-hydroxy-4-carboxy-5-ureidoimidazoline
  • smiles:
    • c(c1(o)(nc(=o)n=c1nc(n)=o))(=o)[o-]
  • inchi-key:
    • whkyncpixmntrq-yfkpbyrvsa-m
  • molecular-weight:
    • 201.118

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-5821&oldid=138918"