Difference between revisions of "CPD-5821"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite HYPOTAURINE == * common-name: ** hypotaurine * smiles: ** c([n+])cs([o-])=o * inchi-key: ** vviubcnyacgllv-uhfffaoysa-n * molecular-weigh...")
(Created page with "Category:metabolite == Metabolite CPD-5821 == * common-name: ** (s)-2-oxo-4-hydroxy-4-carboxy-5-ureidoimidazoline * smiles: ** c(c1(o)(nc(=o)n=c1nc(n)=o))(=o)[o-] * inchi-...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite HYPOTAURINE ==
+
== Metabolite CPD-5821 ==
 
* common-name:
 
* common-name:
** hypotaurine
+
** (s)-2-oxo-4-hydroxy-4-carboxy-5-ureidoimidazoline
 
* smiles:
 
* smiles:
** c([n+])cs([o-])=o
+
** c(c1(o)(nc(=o)n=c1nc(n)=o))(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** vviubcnyacgllv-uhfffaoysa-n
+
** whkyncpixmntrq-yfkpbyrvsa-m
 
* molecular-weight:
 
* molecular-weight:
** 109.143
+
** 201.118
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-6201]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[CYSTEAMINE-DIOXYGENASE-RXN]]
+
* [[3.5.2.17-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=hypotaurine}}
+
{{#set: common-name=(s)-2-oxo-4-hydroxy-4-carboxy-5-ureidoimidazoline}}
{{#set: inchi-key=inchikey=vviubcnyacgllv-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=whkyncpixmntrq-yfkpbyrvsa-m}}
{{#set: molecular-weight=109.143}}
+
{{#set: molecular-weight=201.118}}

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-5821

  • common-name:
    • (s)-2-oxo-4-hydroxy-4-carboxy-5-ureidoimidazoline
  • smiles:
    • c(c1(o)(nc(=o)n=c1nc(n)=o))(=o)[o-]
  • inchi-key:
    • whkyncpixmntrq-yfkpbyrvsa-m
  • molecular-weight:
    • 201.118

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality