Difference between revisions of "CPD-5846"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite URIDINE == * common-name: ** uridine * smiles: ** c(o)c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)) * inchi-key: ** drtqhjpvmgbucf-xvfcmesisa-n *...") |
(Created page with "Category:metabolite == Metabolite CPD-5846 == * common-name: ** 3β-hydroxy-4β-methyl-5α-cholest-7-ene-4α-carboxylate * smiles: ** cc(c)cccc(c)[ch]4(c...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-5846 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3β-hydroxy-4β-methyl-5α-cholest-7-ene-4α-carboxylate |
* smiles: | * smiles: | ||
| − | ** c( | + | ** cc(c)cccc(c)[ch]4(cc[ch]3(c(c)(cc[ch]2(c(=cc[ch]1(c(c)(c([o-])=o)c(ccc(c)12)o))3))4)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** uqfzktihsicspg-dshyqqbwsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 443.688 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[1.1.1.170-RXN]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[1.1.1.170-RXN]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3β-hydroxy-4β-methyl-5α-cholest-7-ene-4α-carboxylate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=uqfzktihsicspg-dshyqqbwsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=443.688}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-5846
- common-name:
- 3β-hydroxy-4β-methyl-5α-cholest-7-ene-4α-carboxylate
- smiles:
- cc(c)cccc(c)[ch]4(cc[ch]3(c(c)(cc[ch]2(c(=cc[ch]1(c(c)(c([o-])=o)c(ccc(c)12)o))3))4))
- inchi-key:
- uqfzktihsicspg-dshyqqbwsa-m
- molecular-weight:
- 443.688
