Difference between revisions of "CPD-5846"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite FRU1P == * common-name: ** β-d-fructofuranose 1-phosphate * smiles: ** c(o)c1(c(o)c(o)c(cop([o-])([o-])=o)(o)o1) * inchi-key: ** rhk...") |
(Created page with "Category:metabolite == Metabolite CPD-763 == * common-name: ** arsenite * smiles: ** [as](o)([o-])o * inchi-key: ** aqlmhyswfmlwbs-uhfffaoysa-n * molecular-weight: ** 124....") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-763 == |
* common-name: | * common-name: | ||
| − | ** | + | ** arsenite |
* smiles: | * smiles: | ||
| − | ** | + | ** [as](o)([o-])o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** aqlmhyswfmlwbs-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 124.936 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[2.1.1.137-RXN]] |
| + | * [[3.6.3.16-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[3.6.3.16-RXN]] | ||
| + | * [[RXN-982]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=arsenite}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=aqlmhyswfmlwbs-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=124.936}} |
Revision as of 18:56, 14 January 2021
Contents
Metabolite CPD-763
- common-name:
- arsenite
- smiles:
- [as](o)([o-])o
- inchi-key:
- aqlmhyswfmlwbs-uhfffaoysa-n
- molecular-weight:
- 124.936
