Difference between revisions of "CPD-590"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 5-PHOSPHO-RIBOSYL-GLYCINEAMIDE == * common-name: ** n1-(5-phospho-β-d-ribosyl)glycinamide * smiles: ** c([n+])c(=o)nc1(c(o)c(o)c(cop...")
(Created page with "Category:metabolite == Metabolite 3Z-dodec-3-enoyl-ACPs == * common-name: ** a (3z)-dodec-3-enoyl-[acp] == Reaction(s) known to consume the compound == * RXN-16615 ==...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 5-PHOSPHO-RIBOSYL-GLYCINEAMIDE ==
+
== Metabolite 3Z-dodec-3-enoyl-ACPs ==
 
* common-name:
 
* common-name:
** n1-(5-phospho-β-d-ribosyl)glycinamide
+
** a (3z)-dodec-3-enoyl-[acp]
* smiles:
 
** c([n+])c(=o)nc1(c(o)c(o)c(cop([o-])(=o)[o-])o1)
 
* inchi-key:
 
** obqmlsfouzuiob-shuuezrqsa-m
 
* molecular-weight:
 
** 285.17
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[FPGFTh]]
+
* [[RXN-16615]]
* [[GART-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[FGFTh]]
 
* [[FPGFTh]]
 
* [[GART-RXN]]
 
* [[GLYRIBONUCSYN-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n1-(5-phospho-β-d-ribosyl)glycinamide}}
+
{{#set: common-name=a (3z)-dodec-3-enoyl-[acp]}}
{{#set: inchi-key=inchikey=obqmlsfouzuiob-shuuezrqsa-m}}
 
{{#set: molecular-weight=285.17}}
 

Revision as of 11:17, 15 January 2021

Metabolite 3Z-dodec-3-enoyl-ACPs

  • common-name:
    • a (3z)-dodec-3-enoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a (3z)-dodec-3-enoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.