Difference between revisions of "CPD-590"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=NITRIC-OXIDE-SYNTHASE-RXN NITRIC-OXIDE-SYNTHASE-RXN] == * direction: ** left-to-right * common-name...")
(Created page with "Category:metabolite == Metabolite CPD-590 == * common-name: ** (2r,3s,4s)-leucocyanidin * smiles: ** c3(c(c2(oc1(c=c(c=c(c=1c(c2o)o)o)o)))=cc(o)=c(c=3)o) * inchi-key: ** s...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=NITRIC-OXIDE-SYNTHASE-RXN NITRIC-OXIDE-SYNTHASE-RXN] ==
+
== Metabolite CPD-590 ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** nitric oxide synthase
+
** (2r,3s,4s)-leucocyanidin
** nitric-oxide synthase
+
* smiles:
* ec-number:
+
** c3(c(c2(oc1(c=c(c=c(c=1c(c2o)o)o)o)))=cc(o)=c(c=3)o)
** [http://enzyme.expasy.org/EC/1.14.13.39 ec-1.14.13.39]
+
* inchi-key:
== Reaction formula ==
+
** sbzwtshafilote-souvjxgzsa-n
* 2 [[ARG]][c] '''+''' 3 [[NADPH]][c] '''+''' 4 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[PROTON]][c] '''=>''' 2 [[L-CITRULLINE]][c] '''+''' 3 [[NADP]][c] '''+''' 2 [[NITRIC-OXIDE]][c] '''+''' 4 [[WATER]][c]
+
* molecular-weight:
== Gene(s) associated with this reaction  ==
+
** 306.271
* Gene: [[SJ17015]]
+
== Reaction(s) known to consume the compound ==
** Category: [[annotation]]
+
* [[RXN-602]]
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) known to produce the compound ==
* Gene: [[SJ17014]]
+
* [[RXN-600]]
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
{{#set: common-name=(2r,3s,4s)-leucocyanidin}}
== Pathway(s) ==
+
{{#set: inchi-key=inchikey=sbzwtshafilote-souvjxgzsa-n}}
* [[PWY-4983]], nitric oxide biosynthesis II (mammals): [http://metacyc.org/META/NEW-IMAGE?object=PWY-4983 PWY-4983]
+
{{#set: molecular-weight=306.271}}
** '''3''' reactions found over '''3''' reactions in the full pathway
 
== Reconstruction information  ==
 
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
== External links  ==
 
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 
* RHEA:
 
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=19898 19898]
 
* LIGAND-RXN:
 
** [http://www.genome.jp/dbget-bin/www_bget?R00557 R00557]
 
* UNIPROT:
 
** [http://www.uniprot.org/uniprot/P29473 P29473]
 
** [http://www.uniprot.org/uniprot/P29477 P29477]
 
** [http://www.uniprot.org/uniprot/P29474 P29474]
 
** [http://www.uniprot.org/uniprot/P35228 P35228]
 
** [http://www.uniprot.org/uniprot/P29475 P29475]
 
** [http://www.uniprot.org/uniprot/Q14961 Q14961]
 
** [http://www.uniprot.org/uniprot/Q27995 Q27995]
 
** [http://www.uniprot.org/uniprot/Q62600 Q62600]
 
** [http://www.uniprot.org/uniprot/Q06518 Q06518]
 
** [http://www.uniprot.org/uniprot/Q9R0W4 Q9R0W4]
 
** [http://www.uniprot.org/uniprot/Q9Z0J4 Q9Z0J4]
 
** [http://www.uniprot.org/uniprot/P29476 P29476]
 
** [http://www.uniprot.org/uniprot/P70313 P70313]
 
** [http://www.uniprot.org/uniprot/Q27571 Q27571]
 
** [http://www.uniprot.org/uniprot/O77104 O77104]
 
** [http://www.uniprot.org/uniprot/O61309 O61309]
 
** [http://www.uniprot.org/uniprot/O61608 O61608]
 
</div>
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=nitric-oxide synthase|nitric oxide synthase}}
 
{{#set: ec-number=ec-1.14.13.39}}
 
{{#set: nb gene associated=2}}
 
{{#set: nb pathway associated=1}}
 
{{#set: reconstruction category=annotation}}
 
{{#set: reconstruction tool=pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-590

  • common-name:
    • (2r,3s,4s)-leucocyanidin
  • smiles:
    • c3(c(c2(oc1(c=c(c=c(c=1c(c2o)o)o)o)))=cc(o)=c(c=3)o)
  • inchi-key:
    • sbzwtshafilote-souvjxgzsa-n
  • molecular-weight:
    • 306.271

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality