Difference between revisions of "CPD-590"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-4578 == * common-name: ** 3-dehydro-4-methylzymosterol * smiles: ** cc(c)=cccc(c)[ch]3(cc[ch]4(c2(cc[ch]1(c(c)c(=o)ccc(c)1c=2ccc(c)34...") |
(Created page with "Category:metabolite == Metabolite CPD-590 == * common-name: ** (2r,3s,4s)-leucocyanidin * smiles: ** c3(c(c2(oc1(c=c(c=c(c=1c(c2o)o)o)o)))=cc(o)=c(c=3)o) * inchi-key: ** s...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-590 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (2r,3s,4s)-leucocyanidin |
* smiles: | * smiles: | ||
| − | ** | + | ** c3(c(c2(oc1(c=c(c=c(c=1c(c2o)o)o)o)))=cc(o)=c(c=3)o) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** sbzwtshafilote-souvjxgzsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 306.271 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-602]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-600]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(2r,3s,4s)-leucocyanidin}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=sbzwtshafilote-souvjxgzsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=306.271}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-590
- common-name:
- (2r,3s,4s)-leucocyanidin
- smiles:
- c3(c(c2(oc1(c=c(c=c(c=1c(c2o)o)o)o)))=cc(o)=c(c=3)o)
- inchi-key:
- sbzwtshafilote-souvjxgzsa-n
- molecular-weight:
- 306.271
