Difference between revisions of "CPD-590"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3Z-dodec-3-enoyl-ACPs == * common-name: ** a (3z)-dodec-3-enoyl-[acp] == Reaction(s) known to consume the compound == * RXN-16615 ==...")
(Created page with "Category:metabolite == Metabolite CPD-590 == * common-name: ** (2r,3s,4s)-leucocyanidin * smiles: ** c3(c(c2(oc1(c=c(c=c(c=1c(c2o)o)o)o)))=cc(o)=c(c=3)o) * inchi-key: ** s...")
 
(4 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3Z-dodec-3-enoyl-ACPs ==
+
== Metabolite CPD-590 ==
 
* common-name:
 
* common-name:
** a (3z)-dodec-3-enoyl-[acp]
+
** (2r,3s,4s)-leucocyanidin
 +
* smiles:
 +
** c3(c(c2(oc1(c=c(c=c(c=1c(c2o)o)o)o)))=cc(o)=c(c=3)o)
 +
* inchi-key:
 +
** sbzwtshafilote-souvjxgzsa-n
 +
* molecular-weight:
 +
** 306.271
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16615]]
+
* [[RXN-602]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-600]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a (3z)-dodec-3-enoyl-[acp]}}
+
{{#set: common-name=(2r,3s,4s)-leucocyanidin}}
 +
{{#set: inchi-key=inchikey=sbzwtshafilote-souvjxgzsa-n}}
 +
{{#set: molecular-weight=306.271}}

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-590

  • common-name:
    • (2r,3s,4s)-leucocyanidin
  • smiles:
    • c3(c(c2(oc1(c=c(c=c(c=1c(c2o)o)o)o)))=cc(o)=c(c=3)o)
  • inchi-key:
    • sbzwtshafilote-souvjxgzsa-n
  • molecular-weight:
    • 306.271

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality