Difference between revisions of "CPD-590"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Triacylglycerols == * common-name: ** a triacyl-sn-glycerol == Reaction(s) known to consume the compound == == Reaction(s) known to produ...")
(Created page with "Category:metabolite == Metabolite 5-PHOSPHO-RIBOSYL-GLYCINEAMIDE == * common-name: ** n1-(5-phospho-β-d-ribosyl)glycinamide * smiles: ** c([n+])c(=o)nc1(c(o)c(o)c(cop...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Triacylglycerols ==
+
== Metabolite 5-PHOSPHO-RIBOSYL-GLYCINEAMIDE ==
 
* common-name:
 
* common-name:
** a triacyl-sn-glycerol
+
** n1-(5-phospho-β-d-ribosyl)glycinamide
 +
* smiles:
 +
** c([n+])c(=o)nc1(c(o)c(o)c(cop([o-])(=o)[o-])o1)
 +
* inchi-key:
 +
** obqmlsfouzuiob-shuuezrqsa-m
 +
* molecular-weight:
 +
** 285.17
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[FPGFTh]]
 +
* [[GART-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DIACYLGLYCEROL-O-ACYLTRANSFERASE-RXN]]
+
* [[FGFTh]]
 +
* [[FPGFTh]]
 +
* [[GART-RXN]]
 +
* [[GLYRIBONUCSYN-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a triacyl-sn-glycerol}}
+
{{#set: common-name=n1-(5-phospho-β-d-ribosyl)glycinamide}}
 +
{{#set: inchi-key=inchikey=obqmlsfouzuiob-shuuezrqsa-m}}
 +
{{#set: molecular-weight=285.17}}

Revision as of 18:57, 14 January 2021

Metabolite 5-PHOSPHO-RIBOSYL-GLYCINEAMIDE

  • common-name:
    • n1-(5-phospho-β-d-ribosyl)glycinamide
  • smiles:
    • c([n+])c(=o)nc1(c(o)c(o)c(cop([o-])(=o)[o-])o1)
  • inchi-key:
    • obqmlsfouzuiob-shuuezrqsa-m
  • molecular-weight:
    • 285.17

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality