Difference between revisions of "CPD-591"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14405 == * common-name: ** 3r-hydroxy-dihomo γ-linolenoyl-coa * smiles: ** cccccc=ccc=ccc=cccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c...")
(Created page with "Category:metabolite == Metabolite 2-AMINOPHENOL == * common-name: ** 2-aminophenol * smiles: ** c1(c=c(n)c(=cc=1)o) * inchi-key: ** cdawcloxvubkrw-uhfffaoysa-n * molecular...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14405 ==
+
== Metabolite 2-AMINOPHENOL ==
 
* common-name:
 
* common-name:
** 3r-hydroxy-dihomo γ-linolenoyl-coa
+
** 2-aminophenol
 
* smiles:
 
* smiles:
** cccccc=ccc=ccc=cccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c1(c=c(n)c(=cc=1)o)
 
* inchi-key:
 
* inchi-key:
** gfvfsxuaklzogc-nulwuihisa-j
+
** cdawcloxvubkrw-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 1067.974
+
** 109.127
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12969]]
+
* [[O-AMINOPHENOL-OXIDASE-RXN]]
 +
* [[RXN-13159]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12968]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3r-hydroxy-dihomo γ-linolenoyl-coa}}
+
{{#set: common-name=2-aminophenol}}
{{#set: inchi-key=inchikey=gfvfsxuaklzogc-nulwuihisa-j}}
+
{{#set: inchi-key=inchikey=cdawcloxvubkrw-uhfffaoysa-n}}
{{#set: molecular-weight=1067.974}}
+
{{#set: molecular-weight=109.127}}

Revision as of 11:16, 15 January 2021

Metabolite 2-AMINOPHENOL

  • common-name:
    • 2-aminophenol
  • smiles:
    • c1(c=c(n)c(=cc=1)o)
  • inchi-key:
    • cdawcloxvubkrw-uhfffaoysa-n
  • molecular-weight:
    • 109.127

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality