Difference between revisions of "CPD-592"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-606 == * common-name: ** cdp-glycerol * smiles: ** c(o)c(o)cop(op(occ2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))(=o)[o-])(=o)[o-] * inchi-ke...") |
(Created page with "Category:metabolite == Metabolite CPD-592 == * common-name: ** 4-guanidinobutanoate * smiles: ** c([o-])(=o)cccnc(=[n+])n * inchi-key: ** tuhveajximeosa-uhfffaoysa-n * mol...") |
||
(4 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-592 == |
* common-name: | * common-name: | ||
− | ** | + | ** 4-guanidinobutanoate |
* smiles: | * smiles: | ||
− | ** c(o) | + | ** c([o-])(=o)cccnc(=[n+])n |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** tuhveajximeosa-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 145.161 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[GUANIDINOBUTANAMIDE-NH3-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=4-guanidinobutanoate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=tuhveajximeosa-uhfffaoysa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=145.161}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-592
- common-name:
- 4-guanidinobutanoate
- smiles:
- c([o-])(=o)cccnc(=[n+])n
- inchi-key:
- tuhveajximeosa-uhfffaoysa-n
- molecular-weight:
- 145.161