Difference between revisions of "CPD-592"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ09895 == * transcription-direction: ** negative * right-end-position: ** 223877 * left-end-position: ** 210318 * centisome-position: ** 51.997776...")
(Created page with "Category:metabolite == Metabolite CPD-13188 == * common-name: ** β-d-glcp-(1→4)-α-l-rhap-(1→3)-d-glcp * smiles: ** cc2(oc(oc1(c(o)c(o)oc(co)c(o)1))c(o...")
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ09895 ==
+
== Metabolite CPD-13188 ==
* transcription-direction:
+
* common-name:
** negative
+
** β-d-glcp-(1→4)-α-l-rhap-(1→3)-d-glcp
* right-end-position:
+
* smiles:
** 223877
+
** cc2(oc(oc1(c(o)c(o)oc(co)c(o)1))c(o)c(o)c2oc3(oc(co)c(c(o)c(o)3)o))
* left-end-position:
+
* inchi-key:
** 210318
+
** cwvrqjbcbctflt-civpzrojsa-n
* centisome-position:
+
* molecular-weight:
** 51.997776   
+
** 488.442
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
== Reaction(s) associated ==
+
* [[RXN-12270]]
* [[3.1.3.16-RXN]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=β-d-glcp-(1→4)-α-l-rhap-(1→3)-d-glcp}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=cwvrqjbcbctflt-civpzrojsa-n}}
* [[4-NITROPHENYLPHOSPHATASE-RXN]]
+
{{#set: molecular-weight=488.442}}
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[PROTEIN-TYROSINE-PHOSPHATASE-RXN]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
{{#set: transcription-direction=negative}}
 
{{#set: right-end-position=223877}}
 
{{#set: left-end-position=210318}}
 
{{#set: centisome-position=51.997776    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=3}}
 

Revision as of 20:33, 18 December 2020

Metabolite CPD-13188

  • common-name:
    • β-d-glcp-(1→4)-α-l-rhap-(1→3)-d-glcp
  • smiles:
    • cc2(oc(oc1(c(o)c(o)oc(co)c(o)1))c(o)c(o)c2oc3(oc(co)c(c(o)c(o)3)o))
  • inchi-key:
    • cwvrqjbcbctflt-civpzrojsa-n
  • molecular-weight:
    • 488.442

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality