Difference between revisions of "CPD-592"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13188 == * common-name: ** β-d-glcp-(1→4)-α-l-rhap-(1→3)-d-glcp * smiles: ** cc2(oc(oc1(c(o)c(o)oc(co)c(o)1))c(o...")
(Created page with "Category:metabolite == Metabolite 3-Oxo-5-Alpha-Steroids == * common-name: ** a 3-oxo-5-α-steroid == Reaction(s) known to consume the compound == * RXN-13682 ==...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-13188 ==
+
== Metabolite 3-Oxo-5-Alpha-Steroids ==
 
* common-name:
 
* common-name:
** β-d-glcp-(1→4)-α-l-rhap-(1→3)-d-glcp
+
** a 3-oxo-5-α-steroid
* smiles:
 
** cc2(oc(oc1(c(o)c(o)oc(co)c(o)1))c(o)c(o)c2oc3(oc(co)c(c(o)c(o)3)o))
 
* inchi-key:
 
** cwvrqjbcbctflt-civpzrojsa-n
 
* molecular-weight:
 
** 488.442
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-13682]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12270]]
+
* [[1.3.99.5-RXN]]
 +
* [[RXN-13682]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=β-d-glcp-(1→4)-α-l-rhap-(1→3)-d-glcp}}
+
{{#set: common-name=a 3-oxo-5-α-steroid}}
{{#set: inchi-key=inchikey=cwvrqjbcbctflt-civpzrojsa-n}}
 
{{#set: molecular-weight=488.442}}
 

Revision as of 14:56, 5 January 2021

Metabolite 3-Oxo-5-Alpha-Steroids

  • common-name:
    • a 3-oxo-5-α-steroid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality