Difference between revisions of "CPD-592"

Revision as of 13:10, 14 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-606 ==
+== Metabolite GLYCEROL-3P ==
 * common-name:
-** cdp-glycerol
+** sn-glycerol 3-phosphate
 * smiles:
-** c(o)c(o)cop(op(occ2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))(=o)[o-])(=o)[o-]
+** c(op([o-])(=o)[o-])c(o)co
 * inchi-key:
-** hhpouccvoneprk-jbsykwbfsa-l
+** awucvroldviajx-gsvougtgsa-l
 * molecular-weight:
-** 475.242
+** 170.058
 == Reaction(s) known to consume the compound ==
 * [[CDP-GLYCEROL-PYROPHOSPHATASE-RXN]]
+* [[G3PD2]]
+* [[GLYCEROL-3-PHOSPHATE-OXIDASE-RXN]]
+* [[GLYCEROL-KIN-RXN]]
+* [[PHOSPHAGLYPSYN-RXN]]
+* [[RXN-10462]]
+* [[RXN-13112]]
+* [[RXN-13805]]
+* [[RXN-1381]]
+* [[RXN-14965]]
+* [[RXN-15045]]
+* [[RXN-15740]]
+* [[RXN-15745]]
+* [[RXN-16024]]
+* [[RXN-16117]]
+* [[RXN-17016]]
+* [[RXN-17017]]
+* [[RXN-17018]]
+* [[RXN0-5260]]
 == Reaction(s) known to produce the compound ==
+* [[1.1.1.8-RXN]]
 * [[CDP-GLYCEROL-PYROPHOSPHATASE-RXN]]
+* [[G3PD2]]
+* [[GLYC3PDEHYDROGBIOSYN-RXN]]
+* [[GLYCEROL-KIN-RXN]]
+* [[GLYCPDIESTER-RXN]]
+* [[RXN-13112]]
+* [[RXN-13805]]
+* [[RXN-14073]]
+* [[RXN-14136]]
+* [[RXN-14160]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=cdp-glycerol}}
+{{#set: common-name=sn-glycerol 3-phosphate}}
-{{#set: inchi-key=inchikey=hhpouccvoneprk-jbsykwbfsa-l}}
+{{#set: inchi-key=inchikey=awucvroldviajx-gsvougtgsa-l}}
-{{#set: molecular-weight=475.242}}
+{{#set: molecular-weight=170.058}}