Difference between revisions of "CPD-592"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GLYCEROL-3P == * common-name: ** sn-glycerol 3-phosphate * smiles: ** c(op([o-])(=o)[o-])c(o)co * inchi-key: ** awucvroldviajx-gsvougtgsa...") |
(Created page with "Category:metabolite == Metabolite ACETYLSERINE == * common-name: ** o-acetyl-l-serine * smiles: ** cc(occ([n+])c(=o)[o-])=o * inchi-key: ** vzxpdpzarilfqx-bypyzucnsa-n * m...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite ACETYLSERINE == |
* common-name: | * common-name: | ||
− | ** | + | ** o-acetyl-l-serine |
* smiles: | * smiles: | ||
− | ** | + | ** cc(occ([n+])c(=o)[o-])=o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** vzxpdpzarilfqx-bypyzucnsa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 147.13 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[ACSERLY-RXN]] |
− | + | * [[RXN-12726]] | |
− | + | * [[SULFOCYS-RXN]] | |
− | |||
− | |||
− | * [[RXN- | ||
− | * [[ | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[ACSERLY-RXN]] |
− | * [[ | + | * [[SERINE-O-ACETTRAN-RXN]] |
− | * [[ | + | * [[SULFOCYS-RXN]] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=o-acetyl-l-serine}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=vzxpdpzarilfqx-bypyzucnsa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=147.13}} |
Revision as of 18:55, 14 January 2021
Contents
Metabolite ACETYLSERINE
- common-name:
- o-acetyl-l-serine
- smiles:
- cc(occ([n+])c(=o)[o-])=o
- inchi-key:
- vzxpdpzarilfqx-bypyzucnsa-n
- molecular-weight:
- 147.13