Difference between revisions of "CPD-5923"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13726 RXN-13726] == * direction: ** left-to-right * common-name: ** thiol s-methyltransferase *...") |
(Created page with "Category:metabolite == Metabolite CPD-5923 == * common-name: ** 5'-deoxy-5'-fluoroadenosine * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))f * inchi-key: ** qp...") |
||
| (7 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-5923 == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** | + | ** 5'-deoxy-5'-fluoroadenosine |
| − | * | + | * smiles: |
| − | ** | + | ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))f |
| − | + | * inchi-key: | |
| − | + | ** qpvlkmicbyrpsx-kqynxxcusa-n | |
| − | == | + | * molecular-weight: |
| − | * | + | ** 269.235 |
| − | ** | + | == Reaction(s) known to consume the compound == |
| − | ** | + | * [[RXN-11743]] |
| − | == | + | == Reaction(s) known to produce the compound == |
| − | + | == Reaction(s) of unknown directionality == | |
| − | * | + | {{#set: common-name=5'-deoxy-5'-fluoroadenosine}} |
| − | == | + | {{#set: inchi-key=inchikey=qpvlkmicbyrpsx-kqynxxcusa-n}} |
| − | + | {{#set: molecular-weight=269.235}} | |
| − | {{#set: common-name= | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:18, 18 March 2021
Contents
Metabolite CPD-5923
- common-name:
- 5'-deoxy-5'-fluoroadenosine
- smiles:
- c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))f
- inchi-key:
- qpvlkmicbyrpsx-kqynxxcusa-n
- molecular-weight:
- 269.235
