Difference between revisions of "CPD-596"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14218 RXN-14218] == * direction: ** left-to-right == Reaction formula == * 1 DGDP[c] '''+''...") |
(Created page with "Category:metabolite == Metabolite CPD-596 == * common-name: ** n6,n6-dimethyl-l-arginine * smiles: ** cn(c(=[n+])ncccc([n+])c(=o)[o-])c * inchi-key: ** ydgmgexadbmomj-lurj...") |
||
| (8 intermediate revisions by 4 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-596 == |
| − | * | + | * common-name: |
| − | ** | + | ** n6,n6-dimethyl-l-arginine |
| − | + | * smiles: | |
| − | * | + | ** cn(c(=[n+])ncccc([n+])c(=o)[o-])c |
| − | + | * inchi-key: | |
| − | * | + | ** ydgmgexadbmomj-lurjtmiesa-o |
| − | ** | + | * molecular-weight: |
| − | ** | + | ** 203.264 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | * [[DIMETHYLARGININASE-RXN]] | |
| − | * | + | == Reaction(s) known to produce the compound == |
| − | == | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=n6,n6-dimethyl-l-arginine}} | |
| − | + | {{#set: inchi-key=inchikey=ydgmgexadbmomj-lurjtmiesa-o}} | |
| − | {{#set: | + | {{#set: molecular-weight=203.264}} |
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-596
- common-name:
- n6,n6-dimethyl-l-arginine
- smiles:
- cn(c(=[n+])ncccc([n+])c(=o)[o-])c
- inchi-key:
- ydgmgexadbmomj-lurjtmiesa-o
- molecular-weight:
- 203.264
