Difference between revisions of "CPD-596"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10660 RXN-10660] == * direction: ** left-to-right * common-name: ** 3-hydroxy cis δ9-hexa...")
(Created page with "Category:metabolite == Metabolite CPD-3707 == * common-name: ** adenosine 2',3'-cyclic monophosphate * smiles: ** c4(n=c3(n(c1(c2(c(c(o1)co)op(o2)([o-])=o)))c=nc3=c(n=4)n)...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10660 RXN-10660] ==
+
== Metabolite CPD-3707 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** 3-hydroxy cis δ9-hexadecenoyl-[acp] dehydratase
+
** adenosine 2',3'-cyclic monophosphate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/4.2.1.59 ec-4.2.1.59]
+
** c4(n=c3(n(c1(c2(c(c(o1)co)op(o2)([o-])=o)))c=nc3=c(n=4)n))
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[3-hydroxy-cis-D9-hexaecenoyl-ACPs]][c] '''=>''' 1 [[Trans-D3-cis-D9-hexadecenoyl-ACPs]][c] '''+''' 1 [[WATER]][c]
+
** kmywvddipvnlme-kqynxxcusa-m
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ10275]]
+
** 328.201
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-12057]]
−
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
−
* [[PWY-6282]], palmitoleate biosynthesis I (from (5Z)-dodec-5-enoate): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6282 PWY-6282]
+
== Reaction(s) of unknown directionality ==
−
** '''8''' reactions found over '''9''' reactions in the full pathway
+
{{#set: common-name=adenosine 2',3'-cyclic monophosphate}}
−
== Reconstruction information  ==
+
{{#set: inchi-key=inchikey=kmywvddipvnlme-kqynxxcusa-m}}
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=328.201}}
−
== External links  ==
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=3-hydroxy cis δ9-hexadecenoyl-[acp] dehydratase}}
 
−
{{#set: ec-number=ec-4.2.1.59}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:36, 18 December 2020

Metabolite CPD-3707

  • common-name:
    • adenosine 2',3'-cyclic monophosphate
  • smiles:
    • c4(n=c3(n(c1(c2(c(c(o1)co)op(o2)([o-])=o)))c=nc3=c(n=4)n))
  • inchi-key:
    • kmywvddipvnlme-kqynxxcusa-m
  • molecular-weight:
    • 328.201

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-596&oldid=47926"