Difference between revisions of "CPD-602"

Revision as of 11:17, 15 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-14927 ==
+== Metabolite GERANYLGERANYL-PP ==
 * common-name:
-** phytenate
+** geranylgeranyl diphosphate
 * smiles:
-** cc(c)cccc(c)cccc(c)cccc(c)=cc(=o)[o-]
+** cc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
 * inchi-key:
-** wdwbnnbrpveeod-pfxvradusa-m
+** oinneunvozhbox-qircyjposa-k
 * molecular-weight:
-** 309.511
+** 447.424
 == Reaction(s) known to consume the compound ==
-* [[RXN66-480]]
+* [[2.5.1.32-RXN]]
+* [[2.5.1.41-RXN]]
+* [[2.5.1.42-RXN]]
+* [[RXN-10625]]
+* [[RXN-11486]]
+* [[RXN-11488]]
+* [[RXN-13323]]
+* [[RXN-14929]]
+* [[RXN-17480]]
+* [[RXN-3701]]
+* [[RXN-7658]]
+* [[RXN-7663]]
+* [[RXN-7673]]
+* [[RXN-8788]]
 == Reaction(s) known to produce the compound ==
-* [[RXN66-479]]
+* [[FARNESYLTRANSTRANSFERASE-RXN]]
+* [[GGPS]]
+* [[RXN-3701]]
+* [[RXN-7658]]
+* [[RXN-7673]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=phytenate}}
+{{#set: common-name=geranylgeranyl diphosphate}}
-{{#set: inchi-key=inchikey=wdwbnnbrpveeod-pfxvradusa-m}}
+{{#set: inchi-key=inchikey=oinneunvozhbox-qircyjposa-k}}
-{{#set: molecular-weight=309.511}}
+{{#set: molecular-weight=447.424}}