Difference between revisions of "CPD-602"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite GERANYLGERANYL-PP == * common-name: ** geranylgeranyl diphosphate * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o...")
(Created page with "Category:metabolite == Metabolite 3-hydroxypimeloyl-ACP-methyl-esters == * common-name: ** a (3r)-3-hydroxypimeloyl-[acp] methyl ester == Reaction(s) known to consume the...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite GERANYLGERANYL-PP ==
+
== Metabolite 3-hydroxypimeloyl-ACP-methyl-esters ==
 
* common-name:
 
* common-name:
** geranylgeranyl diphosphate
+
** a (3r)-3-hydroxypimeloyl-[acp] methyl ester
* smiles:
 
** cc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
 
* inchi-key:
 
** oinneunvozhbox-qircyjposa-k
 
* molecular-weight:
 
** 447.424
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.5.1.32-RXN]]
+
* [[RXN-11481]]
* [[2.5.1.41-RXN]]
 
* [[2.5.1.42-RXN]]
 
* [[RXN-10625]]
 
* [[RXN-11486]]
 
* [[RXN-11488]]
 
* [[RXN-13323]]
 
* [[RXN-14929]]
 
* [[RXN-17480]]
 
* [[RXN-3701]]
 
* [[RXN-7658]]
 
* [[RXN-7663]]
 
* [[RXN-7673]]
 
* [[RXN-8788]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[FARNESYLTRANSTRANSFERASE-RXN]]
+
* [[RXN-11480]]
* [[GGPS]]
 
* [[RXN-3701]]
 
* [[RXN-7658]]
 
* [[RXN-7673]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=geranylgeranyl diphosphate}}
+
{{#set: common-name=a (3r)-3-hydroxypimeloyl-[acp] methyl ester}}
{{#set: inchi-key=inchikey=oinneunvozhbox-qircyjposa-k}}
 
{{#set: molecular-weight=447.424}}
 

Revision as of 08:29, 15 March 2021

Metabolite 3-hydroxypimeloyl-ACP-methyl-esters

  • common-name:
    • a (3r)-3-hydroxypimeloyl-[acp] methyl ester

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a (3r)-3-hydroxypimeloyl-[acp] methyl ester" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.