Difference between revisions of "CPD-602"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GERANYLGERANYL-PP == * common-name: ** geranylgeranyl diphosphate * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o...") |
(Created page with "Category:metabolite == Metabolite CPD-602 == * common-name: ** 5-amino-6-(5-phospho-d-ribosylamino)uracil * smiles: ** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)nc2(=c(n)c(=o)nc(...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-602 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 5-amino-6-(5-phospho-d-ribosylamino)uracil |
* smiles: | * smiles: | ||
| − | ** | + | ** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)nc2(=c(n)c(=o)nc(=o)n2)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** lzexycagpmyxlx-ummcilcdsa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 352.197 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RIBOFLAVINSYNREDUC-RXN]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RIBOFLAVINSYNDEAM-RXN]] |
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=5-amino-6-(5-phospho-d-ribosylamino)uracil}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=lzexycagpmyxlx-ummcilcdsa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=352.197}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-602
- common-name:
- 5-amino-6-(5-phospho-d-ribosylamino)uracil
- smiles:
- c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)nc2(=c(n)c(=o)nc(=o)n2))
- inchi-key:
- lzexycagpmyxlx-ummcilcdsa-l
- molecular-weight:
- 352.197
