Difference between revisions of "CPD-602"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-hydroxypimeloyl-ACP-methyl-esters == * common-name: ** a (3r)-3-hydroxypimeloyl-[acp] methyl ester == Reaction(s) known to consume the...")
(Created page with "Category:metabolite == Metabolite CPD-602 == * common-name: ** 5-amino-6-(5-phospho-d-ribosylamino)uracil * smiles: ** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)nc2(=c(n)c(=o)nc(...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-hydroxypimeloyl-ACP-methyl-esters ==
+
== Metabolite CPD-602 ==
 
* common-name:
 
* common-name:
** a (3r)-3-hydroxypimeloyl-[acp] methyl ester
+
** 5-amino-6-(5-phospho-d-ribosylamino)uracil
 +
* smiles:
 +
** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)nc2(=c(n)c(=o)nc(=o)n2))
 +
* inchi-key:
 +
** lzexycagpmyxlx-ummcilcdsa-l
 +
* molecular-weight:
 +
** 352.197
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11481]]
+
* [[RIBOFLAVINSYNREDUC-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11480]]
+
* [[RIBOFLAVINSYNDEAM-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a (3r)-3-hydroxypimeloyl-[acp] methyl ester}}
+
{{#set: common-name=5-amino-6-(5-phospho-d-ribosylamino)uracil}}
 +
{{#set: inchi-key=inchikey=lzexycagpmyxlx-ummcilcdsa-l}}
 +
{{#set: molecular-weight=352.197}}

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-602

  • common-name:
    • 5-amino-6-(5-phospho-d-ribosylamino)uracil
  • smiles:
    • c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)nc2(=c(n)c(=o)nc(=o)n2))
  • inchi-key:
    • lzexycagpmyxlx-ummcilcdsa-l
  • molecular-weight:
    • 352.197

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality