Difference between revisions of "CPD-606"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-329 == * common-name: ** l-xylo-hex-3-ulono-1,4-lactone * smiles: ** c(c(o)[ch]1(oc(=o)c(o)c(=o)1))o * inchi-key: ** pjbqwwhytvymlo-l...") |
(Created page with "Category:metabolite == Metabolite CPD-606 == * common-name: ** cdp-glycerol * smiles: ** c(o)c(o)cop(op(occ2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))(=o)[o-])(=o)[o-] * inchi-ke...") |
||
(4 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-606 == |
* common-name: | * common-name: | ||
− | ** | + | ** cdp-glycerol |
* smiles: | * smiles: | ||
− | ** c(c(o) | + | ** c(o)c(o)cop(op(occ2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))(=o)[o-])(=o)[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** hhpouccvoneprk-jbsykwbfsa-l |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 475.242 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[CDP-GLYCEROL-PYROPHOSPHATASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[CDP-GLYCEROL-PYROPHOSPHATASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=cdp-glycerol}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=hhpouccvoneprk-jbsykwbfsa-l}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=475.242}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-606
- common-name:
- cdp-glycerol
- smiles:
- c(o)c(o)cop(op(occ2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))(=o)[o-])(=o)[o-]
- inchi-key:
- hhpouccvoneprk-jbsykwbfsa-l
- molecular-weight:
- 475.242