Difference between revisions of "CPD-606"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ18765 == * transcription-direction: ** negative * right-end-position: ** 167790 * left-end-position: ** 159574 * centisome-position: ** 67.5094...")
 
(Created page with "Category:metabolite == Metabolite CPD-606 == * common-name: ** cdp-glycerol * smiles: ** c(o)c(o)cop(op(occ2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))(=o)[o-])(=o)[o-] * inchi-ke...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ18765 ==
+
== Metabolite CPD-606 ==
* transcription-direction:
+
* common-name:
** negative
+
** cdp-glycerol
* right-end-position:
+
* smiles:
** 167790
+
** c(o)c(o)cop(op(occ2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))(=o)[o-])(=o)[o-]
* left-end-position:
+
* inchi-key:
** 159574
+
** hhpouccvoneprk-jbsykwbfsa-l
* centisome-position:
+
* molecular-weight:
** 67.5094   
+
** 475.242
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[CDP-GLYCEROL-PYROPHOSPHATASE-RXN]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[3.4.19.12-RXN]]
+
* [[CDP-GLYCEROL-PYROPHOSPHATASE-RXN]]
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=cdp-glycerol}}
{{#set: transcription-direction=negative}}
+
{{#set: inchi-key=inchikey=hhpouccvoneprk-jbsykwbfsa-l}}
{{#set: right-end-position=167790}}
+
{{#set: molecular-weight=475.242}}
{{#set: left-end-position=159574}}
 
{{#set: centisome-position=67.5094    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=1}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-606

  • common-name:
    • cdp-glycerol
  • smiles:
    • c(o)c(o)cop(op(occ2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))(=o)[o-])(=o)[o-]
  • inchi-key:
    • hhpouccvoneprk-jbsykwbfsa-l
  • molecular-weight:
    • 475.242

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality