Difference between revisions of "CPD-606"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-Ketoglutaryl-ACP-methyl-ester == * common-name: ** a 3-oxo-glutaryl-[acp] methyl ester == Reaction(s) known to consume the compound ==...") |
(Created page with "Category:metabolite == Metabolite CPD-606 == * common-name: ** cdp-glycerol * smiles: ** c(o)c(o)cop(op(occ2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))(=o)[o-])(=o)[o-] * inchi-ke...") |
||
| (2 intermediate revisions by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-606 == |
* common-name: | * common-name: | ||
| − | ** | + | ** cdp-glycerol |
| + | * smiles: | ||
| + | ** c(o)c(o)cop(op(occ2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))(=o)[o-])(=o)[o-] | ||
| + | * inchi-key: | ||
| + | ** hhpouccvoneprk-jbsykwbfsa-l | ||
| + | * molecular-weight: | ||
| + | ** 475.242 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[CDP-GLYCEROL-PYROPHOSPHATASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[CDP-GLYCEROL-PYROPHOSPHATASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=cdp-glycerol}} |
| + | {{#set: inchi-key=inchikey=hhpouccvoneprk-jbsykwbfsa-l}} | ||
| + | {{#set: molecular-weight=475.242}} | ||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-606
- common-name:
- cdp-glycerol
- smiles:
- c(o)c(o)cop(op(occ2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))(=o)[o-])(=o)[o-]
- inchi-key:
- hhpouccvoneprk-jbsykwbfsa-l
- molecular-weight:
- 475.242
