Difference between revisions of "CPD-609"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Guanine9-in-tRNA == * common-name: ** a guanine9 in trna == Reaction(s) known to consume the compound == * RXN-12459 == Reaction(s) k...") |
(Created page with "Category:metabolite == Metabolite CPD-609 == * common-name: ** p1,p4-bis(5'-guanosyl) tetraphosphate * smiles: ** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])op(=o)([o-])occ1(oc...") |
||
| (5 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-609 == |
* common-name: | * common-name: | ||
| − | ** | + | ** p1,p4-bis(5'-guanosyl) tetraphosphate |
| + | * smiles: | ||
| + | ** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))))c4(oc(c(o)c(o)4)n6(c=nc5(c(=o)nc(n)=nc=56))) | ||
| + | * inchi-key: | ||
| + | ** olgwxcqxrssqpo-mharetsrsa-j | ||
| + | * molecular-weight: | ||
| + | ** 864.359 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[3.6.1.17-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=p1,p4-bis(5'-guanosyl) tetraphosphate}} |
| + | {{#set: inchi-key=inchikey=olgwxcqxrssqpo-mharetsrsa-j}} | ||
| + | {{#set: molecular-weight=864.359}} | ||
Latest revision as of 11:18, 18 March 2021
Contents
Metabolite CPD-609
- common-name:
- p1,p4-bis(5'-guanosyl) tetraphosphate
- smiles:
- c(op(=o)([o-])op(=o)([o-])op(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))))c4(oc(c(o)c(o)4)n6(c=nc5(c(=o)nc(n)=nc=56)))
- inchi-key:
- olgwxcqxrssqpo-mharetsrsa-j
- molecular-weight:
- 864.359
