Difference between revisions of "CPD-61"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.4.21.105-RXN 3.4.21.105-RXN] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expa...") |
(Created page with "Category:metabolite == Metabolite CPD-61 == * common-name: ** (2r,3s)-2,3-dimethylmalate * smiles: ** cc(c(=o)[o-])c(c)(o)c(=o)[o-] * inchi-key: ** wtiiulqjlzehgz-cvyqjglw...") |
||
| (9 intermediate revisions by 4 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-61 == |
| − | * | + | * common-name: |
| − | ** | + | ** (2r,3s)-2,3-dimethylmalate |
| − | * | + | * smiles: |
| − | ** | + | ** cc(c(=o)[o-])c(c)(o)c(=o)[o-] |
| − | = | + | * inchi-key: |
| − | + | ** wtiiulqjlzehgz-cvyqjglwsa-l | |
| − | + | * molecular-weight: | |
| − | * | + | ** 160.126 |
| − | ** | + | == Reaction(s) known to consume the compound == |
| − | ** | + | * [[23-DIMETHYLMALATE-LYASE-RXN]] |
| − | == | + | == Reaction(s) known to produce the compound == |
| − | + | == Reaction(s) of unknown directionality == | |
| − | * | + | {{#set: common-name=(2r,3s)-2,3-dimethylmalate}} |
| − | == | + | {{#set: inchi-key=inchikey=wtiiulqjlzehgz-cvyqjglwsa-l}} |
| − | + | {{#set: molecular-weight=160.126}} | |
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-61
- common-name:
- (2r,3s)-2,3-dimethylmalate
- smiles:
- cc(c(=o)[o-])c(c)(o)c(=o)[o-]
- inchi-key:
- wtiiulqjlzehgz-cvyqjglwsa-l
- molecular-weight:
- 160.126
