Difference between revisions of "CPD-611"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9066 == * smiles: ** ccc5(c(c)c9(n6([mg]27(n1(c(c(c)c(ccc(=o)[o-])c=1c4([c-](c(oc)=o)c(=o)c3(=c(c)c(n2c3=4)=cc5=6)))=cc8(=c(c)c(c(c)=...")
(Created page with "Category:metabolite == Metabolite GDP-D-GLUCOSE == * common-name: ** gdp-α-d-glucose * smiles: ** c(o)c1(c(o)c(o)c(o)c(o1)op([o-])(=o)op([o-])(=o)occ2(oc(c(o)c(o)2)n...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9066 ==
+
== Metabolite GDP-D-GLUCOSE ==
 +
* common-name:
 +
** gdp-α-d-glucose
 
* smiles:
 
* smiles:
** ccc5(c(c)c9(n6([mg]27(n1(c(c(c)c(ccc(=o)[o-])c=1c4([c-](c(oc)=o)c(=o)c3(=c(c)c(n2c3=4)=cc5=6)))=cc8(=c(c)c(c(c)=o)=c(n78)c=9))))))
+
** c(o)c1(c(o)c(o)c(o)c(o1)op([o-])(=o)op([o-])(=o)occ2(oc(c(o)c(o)2)n4(c=nc3(c(=o)nc(n)=nc=34))))
* common-name:
+
* inchi-key:
** bacteriochlorophyllide a
+
** mvmscbbuihutgj-lrjdveewsa-l
 
* molecular-weight:
 
* molecular-weight:
** 630.982
+
** 603.329
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8788]]
+
* [[RXN-12486]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-12486]]
 +
* [[RXN4FS-13]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=bacteriochlorophyllide a}}
+
{{#set: common-name=gdp-α-d-glucose}}
{{#set: molecular-weight=630.982}}
+
{{#set: inchi-key=inchikey=mvmscbbuihutgj-lrjdveewsa-l}}
 +
{{#set: molecular-weight=603.329}}

Revision as of 11:17, 15 January 2021

Metabolite GDP-D-GLUCOSE

  • common-name:
    • gdp-α-d-glucose
  • smiles:
    • c(o)c1(c(o)c(o)c(o)c(o1)op([o-])(=o)op([o-])(=o)occ2(oc(c(o)c(o)2)n4(c=nc3(c(=o)nc(n)=nc=34))))
  • inchi-key:
    • mvmscbbuihutgj-lrjdveewsa-l
  • molecular-weight:
    • 603.329

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality