Difference between revisions of "CPD-6242"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPDQT-40 == * common-name: ** 3-[(7'-methylthio)heptyl]malate * smiles: ** cscccccccc(c(o)c(=o)[o-])c(=o)[o-] * inchi-key: ** sxljfgxgvbw...") |
(Created page with "Category:metabolite == Metabolite CPD-6242 == * common-name: ** a protein-o-(n-acetyl-d-glucosaminyl)-trans-4-hydroxy-l-proline == Reaction(s) known to consume the compoun...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-6242 == |
* common-name: | * common-name: | ||
| − | ** | + | ** a protein-o-(n-acetyl-d-glucosaminyl)-trans-4-hydroxy-l-proline |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[2.4.1.229-RXN]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[2.4.1.229-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a protein-o-(n-acetyl-d-glucosaminyl)-trans-4-hydroxy-l-proline}} |
| − | |||
| − | |||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-6242
- common-name:
- a protein-o-(n-acetyl-d-glucosaminyl)-trans-4-hydroxy-l-proline
