Difference between revisions of "CPD-6242"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17780 RXN-17780] == * direction: ** left-to-right * common-name: ** enoyl-coa hydratase * ec-nu...") |
(Created page with "Category:metabolite == Metabolite CPDQT-40 == * common-name: ** 3-[(7'-methylthio)heptyl]malate * smiles: ** cscccccccc(c(o)c(=o)[o-])c(=o)[o-] * inchi-key: ** sxljfgxgvbw...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPDQT-40 == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** | + | ** 3-[(7'-methylthio)heptyl]malate |
| − | * | + | * smiles: |
| − | ** | + | ** cscccccccc(c(o)c(=o)[o-])c(=o)[o-] |
| − | + | * inchi-key: | |
| − | + | ** sxljfgxgvbwoob-uhfffaoysa-l | |
| − | + | * molecular-weight: | |
| − | + | ** 276.347 | |
| − | + | == Reaction(s) known to consume the compound == | |
| − | + | * [[RXN-18200]] | |
| − | + | * [[RXNQT-4178]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-18200]] | |
| − | * | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=3-[(7'-methylthio)heptyl]malate}} | |
| − | + | {{#set: inchi-key=inchikey=sxljfgxgvbwoob-uhfffaoysa-l}} | |
| − | ** | + | {{#set: molecular-weight=276.347}} |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | * | ||
| − | |||
| − | ** | ||
| − | |||
| − | * | ||
| − | * | ||
| − | |||
| − | |||
| − | |||
| − | == | ||
| − | |||
| − | * | ||
| − | |||
| − | == | ||
| − | |||
| − | {{#set: common-name= | ||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
Revision as of 20:34, 18 December 2020
Contents
Metabolite CPDQT-40
- common-name:
- 3-[(7'-methylthio)heptyl]malate
- smiles:
- cscccccccc(c(o)c(=o)[o-])c(=o)[o-]
- inchi-key:
- sxljfgxgvbwoob-uhfffaoysa-l
- molecular-weight:
- 276.347
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "3-[(7'-methylthio)heptyl]malate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
