Difference between revisions of "CPD-6321"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite IMIDAZOLE-ACETOL-P == * common-name: ** imidazole acetol-phosphate * smiles: ** c1(nc=nc=1cc(cop([o-])(=o)[o-])=o) * inchi-key: ** ycffms...") |
(Created page with "Category:metabolite == Metabolite CPD-6321 == * common-name: ** a [procollagen] trans 4-hyroxy-l-proline == Reaction(s) known to consume the compound == == Reaction(s) kno...") |
||
(2 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-6321 == |
* common-name: | * common-name: | ||
− | ** | + | ** a [procollagen] trans 4-hyroxy-l-proline |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[1.14.11.2-RXN]] |
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a [procollagen] trans 4-hyroxy-l-proline}} |
− | |||
− |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-6321
- common-name:
- a [procollagen] trans 4-hyroxy-l-proline
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [procollagen] trans 4-hyroxy-l-proline" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.