Difference between revisions of "CPD-6321"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13576 == * common-name: ** 2-(2-carboxy-4-methylthiazol-5-yl)ethyl phosphate * smiles: ** cc1(=c(ccop([o-])(=o)[o-])sc(c(=o)[o-])=n1)...")
(Created page with "Category:metabolite == Metabolite NN-DIMETHYLANILINE-N-OXIDE == * common-name: ** n,n-dimethylaniline-n-oxide * smiles: ** cn(c)(=o)c1(c=cc=cc=1) * inchi-key: ** lkqudaoam...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-13576 ==
+
== Metabolite NN-DIMETHYLANILINE-N-OXIDE ==
 
* common-name:
 
* common-name:
** 2-(2-carboxy-4-methylthiazol-5-yl)ethyl phosphate
+
** n,n-dimethylaniline-n-oxide
 
* smiles:
 
* smiles:
** cc1(=c(ccop([o-])(=o)[o-])sc(c(=o)[o-])=n1)
+
** cn(c)(=o)c1(c=cc=cc=1)
 
* inchi-key:
 
* inchi-key:
** xwecmahakfwynv-uhfffaoysa-k
+
** lkqudaoambkkqw-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 264.169
+
** 137.181
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12610]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[1.14.13.8-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-(2-carboxy-4-methylthiazol-5-yl)ethyl phosphate}}
+
{{#set: common-name=n,n-dimethylaniline-n-oxide}}
{{#set: inchi-key=inchikey=xwecmahakfwynv-uhfffaoysa-k}}
+
{{#set: inchi-key=inchikey=lkqudaoambkkqw-uhfffaoysa-n}}
{{#set: molecular-weight=264.169}}
+
{{#set: molecular-weight=137.181}}

Revision as of 14:55, 5 January 2021

Metabolite NN-DIMETHYLANILINE-N-OXIDE

  • common-name:
    • n,n-dimethylaniline-n-oxide
  • smiles:
    • cn(c)(=o)c1(c=cc=cc=1)
  • inchi-key:
    • lkqudaoambkkqw-uhfffaoysa-n
  • molecular-weight:
    • 137.181

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality