Difference between revisions of "CPD-641"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GUANIDINOBUTANAMIDE-NH3-RXN GUANIDINOBUTANAMIDE-NH3-RXN] == * direction: ** left-to-right * common-...")
(Created page with "Category:metabolite == Metabolite CPD-641 == * common-name: ** (r)-mevalonate diphosphate * smiles: ** cc(o)(ccop(=o)([o-])op([o-])([o-])=o)cc(=o)[o-] * inchi-key: ** sigq...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=GUANIDINOBUTANAMIDE-NH3-RXN GUANIDINOBUTANAMIDE-NH3-RXN] ==
+
== Metabolite CPD-641 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** amidase
+
** (r)-mevalonate diphosphate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/3.5.1.4 ec-3.5.1.4]
+
** cc(o)(ccop(=o)([o-])op([o-])([o-])=o)cc(=o)[o-]
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[4-GUANIDO-BUTYRAMIDE]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[AMMONIUM]][c] '''+''' 1 [[CPD-592]][c]
+
** sigqqubjqxsamw-zcfiwibfsa-j
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ16279]]
+
** 304.087
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[DIPHOSPHOMEVALONTE-DECARBOXYLASE-RXN]]
−
* Gene: [[SJ01848]]
+
* [[PHOSPHOMEVALONATE-KINASE-RXN]]
−
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[PHOSPHOMEVALONATE-KINASE-RXN]]
−
** Category: [[orthology]]
+
== Reaction(s) of unknown directionality ==
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
{{#set: common-name=(r)-mevalonate diphosphate}}
−
* Gene: [[SJ22527]]
+
{{#set: inchi-key=inchikey=sigqqubjqxsamw-zcfiwibfsa-j}}
−
** Category: [[annotation]]
+
{{#set: molecular-weight=304.087}}
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
* Gene: [[SJ11012]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
** Category: [[orthology]]
 
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
== Pathway(s) ==
 
−
* [[ARGDEG-V-PWY]], L-arginine degradation X (arginine monooxygenase pathway): [http://metacyc.org/META/NEW-IMAGE?object=ARGDEG-V-PWY ARGDEG-V-PWY]
 
−
** '''1''' reactions found over '''3''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=34376 34376]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R03180 R03180]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=amidase}}
 
−
{{#set: ec-number=ec-3.5.1.4}}
 
−
{{#set: nb gene associated=4}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation|orthology}}
 
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-641

  • common-name:
    • (r)-mevalonate diphosphate
  • smiles:
    • cc(o)(ccop(=o)([o-])op([o-])([o-])=o)cc(=o)[o-]
  • inchi-key:
    • sigqqubjqxsamw-zcfiwibfsa-j
  • molecular-weight:
    • 304.087

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-641&oldid=138613"