Difference between revisions of "CPD-641"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17814 == * common-name: ** (11z)-(s)-3-hydroxyhexadec-11-enoyl-coa * smiles: ** ccccc=ccccccccc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o...") |
(Created page with "Category:metabolite == Metabolite CPD-641 == * common-name: ** (r)-mevalonate diphosphate * smiles: ** cc(o)(ccop(=o)([o-])op([o-])([o-])=o)cc(=o)[o-] * inchi-key: ** sigq...") |
||
| (5 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-641 == |
* common-name: | * common-name: | ||
| − | ** ( | + | ** (r)-mevalonate diphosphate |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(o)(ccop(=o)([o-])op([o-])([o-])=o)cc(=o)[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** sigqqubjqxsamw-zcfiwibfsa-j |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 304.087 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[DIPHOSPHOMEVALONTE-DECARBOXYLASE-RXN]] |
| + | * [[PHOSPHOMEVALONATE-KINASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[PHOSPHOMEVALONATE-KINASE-RXN]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=( | + | {{#set: common-name=(r)-mevalonate diphosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=sigqqubjqxsamw-zcfiwibfsa-j}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=304.087}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-641
- common-name:
- (r)-mevalonate diphosphate
- smiles:
- cc(o)(ccop(=o)([o-])op([o-])([o-])=o)cc(=o)[o-]
- inchi-key:
- sigqqubjqxsamw-zcfiwibfsa-j
- molecular-weight:
- 304.087
