Difference between revisions of "CPD-6442"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7087 == * common-name: ** (+)-dihydromyricetin * smiles: ** c3(c(c2(oc1(c=c(c=c(c=1c(c2o)=o)o)[o-])))=cc(=c(c=3o)o)o) * inchi-key: **...") |
(Created page with "Category:metabolite == Metabolite Demethylmenaquinols == * common-name: ** a demethylmenaquinol == Reaction(s) known to consume the compound == * RXN-11046 == Reaction...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Demethylmenaquinols == |
* common-name: | * common-name: | ||
| − | ** | + | ** a demethylmenaquinol |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-11046]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a demethylmenaquinol}} |
| − | |||
| − | |||
Revision as of 08:30, 15 March 2021
Contents
Metabolite Demethylmenaquinols
- common-name:
- a demethylmenaquinol
